C13H16N2O3S — CID 54886109
1-[3-(aminomethyl)phenyl]-N-(furan-2-ylmethyl)methanesulfonamide (PubChem CID 54886109) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]-N-(furan-2-ylmethyl)methanesulfonamide.
| Compound Name | 1-[3-(aminomethyl)phenyl]-N-(furan-2-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 54886109 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]-N-(furan-2-ylmethyl)methanesulfonamide |
| SMILES | NCc1cccc(CS(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C13H16N2O3S/c14-8-11-3-1-4-12(7-11)10-19(16,17)15-9-13-5-2-6-18-13/h1-7,15H,8-10,14H2 |
| InChIKey | LPWMOPULUBXZCW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |