C14H16N2O3S2 — CID 61470628
3-[2-(furan-2-yl)ethylsulfamoylmethyl]benzenecarbothioamide (PubChem CID 61470628) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 3-[2-(furan-2-yl)ethylsulfamoylmethyl]benzenecarbothioamide.
| Compound Name | 3-[2-(furan-2-yl)ethylsulfamoylmethyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 61470628 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 3-[2-(furan-2-yl)ethylsulfamoylmethyl]benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(CS(=O)(=O)NCCc2ccco2)c1 |
| InChI | InChI=1S/C14H16N2O3S2/c15-14(20)12-4-1-3-11(9-12)10-21(17,18)16-7-6-13-5-2-8-19-13/h1-5,8-9,16H,6-7,10H2,(H2,15,20) |
| InChIKey | YWNCXJNMUGROIF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|