C12H14N4O3S2 — CID 106399385
3-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfamoylmethyl]benzenecarbothioamide (PubChem CID 106399385) has the molecular formula C12H14N4O3S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfamoylmethyl]benzenecarbothioamide.
| Compound Name | 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfamoylmethyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 106399385 |
| Molecular Formula | C12H14N4O3S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfamoylmethyl]benzenecarbothioamide |
| SMILES | Cc1nc(CNS(=O)(=O)Cc2cccc(C(N)=S)c2)no1 |
| InChI | InChI=1S/C12H14N4O3S2/c1-8-15-11(16-19-8)6-14-21(17,18)7-9-3-2-4-10(5-9)12(13)20/h2-5,14H,6-7H2,1H3,(H2,13,20) |
| InChIKey | FNGGZUYLPNZDOR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|