C10H11N5OS — CID 114183854
2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]pyridine-4-carbothioamide (PubChem CID 114183854) has the molecular formula C10H11N5OS and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]pyridine-4-carbothioamide.
| Compound Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114183854 |
| Molecular Formula | C10H11N5OS |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]pyridine-4-carbothioamide |
| SMILES | Cc1nc(CNc2cc(C(N)=S)ccn2)no1 |
| InChI | InChI=1S/C10H11N5OS/c1-6-14-9(15-16-6)5-13-8-4-7(10(11)17)2-3-12-8/h2-4H,5H2,1H3,(H2,11,17)(H,12,13) |
| InChIKey | OGOLSYGRQKLMHL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|