C13H15N3O3S2 — CID 106372384
3-[(5-methyl-1,3-oxazol-2-yl)methylsulfamoylmethyl]benzenecarbothioamide (PubChem CID 106372384) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 3-[(5-methyl-1,3-oxazol-2-yl)methylsulfamoylmethyl]benzenecarbothioamide.
| Compound Name | 3-[(5-methyl-1,3-oxazol-2-yl)methylsulfamoylmethyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 106372384 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 3-[(5-methyl-1,3-oxazol-2-yl)methylsulfamoylmethyl]benzenecarbothioamide |
| SMILES | Cc1cnc(CNS(=O)(=O)Cc2cccc(C(N)=S)c2)o1 |
| InChI | InChI=1S/C13H15N3O3S2/c1-9-6-15-12(19-9)7-16-21(17,18)8-10-3-2-4-11(5-10)13(14)20/h2-6,16H,7-8H2,1H3,(H2,14,20) |
| InChIKey | WNCJFYONLWCKSX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|