C11H11FN4O3S2 — CID 106399377
2-fluoro-6-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfamoyl]benzenecarbothioamide (PubChem CID 106399377) has the molecular formula C11H11FN4O3S2 and a molecular weight of 330.37 g/mol. Its IUPAC name is 2-fluoro-6-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfamoyl]benzenecarbothioamide.
| Compound Name | 2-fluoro-6-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 106399377 |
| Molecular Formula | C11H11FN4O3S2 |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-fluoro-6-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfamoyl]benzenecarbothioamide |
| SMILES | Cc1nc(CNS(=O)(=O)c2cccc(F)c2C(N)=S)no1 |
| InChI | InChI=1S/C11H11FN4O3S2/c1-6-15-9(16-19-6)5-14-21(17,18)8-4-2-3-7(12)10(8)11(13)20/h2-4,14H,5H2,1H3,(H2,13,20) |
| InChIKey | QGIRPBLNPSGGDL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|