C9H9F3N2O2S2 — CID 115407199
2-(2,2-difluoroethylsulfamoyl)-6-fluorobenzenecarbothioamide (PubChem CID 115407199) has the molecular formula C9H9F3N2O2S2 and a molecular weight of 298.31 g/mol. Its IUPAC name is 2-(2,2-difluoroethylsulfamoyl)-6-fluorobenzenecarbothioamide.
| Compound Name | 2-(2,2-difluoroethylsulfamoyl)-6-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 115407199 |
| Molecular Formula | C9H9F3N2O2S2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 2-(2,2-difluoroethylsulfamoyl)-6-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1c(F)cccc1S(=O)(=O)NCC(F)F |
| InChI | InChI=1S/C9H9F3N2O2S2/c10-5-2-1-3-6(8(5)9(13)17)18(15,16)14-4-7(11)12/h1-3,7,14H,4H2,(H2,13,17) |
| InChIKey | DNIZICFBXVVAOE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|