C11H13FN2O4S2 — CID 106669519
2-(3,4-dihydroxypyrrolidin-1-yl)sulfonyl-6-fluorobenzenecarbothioamide (PubChem CID 106669519) has the molecular formula C11H13FN2O4S2 and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-(3,4-dihydroxypyrrolidin-1-yl)sulfonyl-6-fluorobenzenecarbothioamide.
| Compound Name | 2-(3,4-dihydroxypyrrolidin-1-yl)sulfonyl-6-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 106669519 |
| Molecular Formula | C11H13FN2O4S2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-(3,4-dihydroxypyrrolidin-1-yl)sulfonyl-6-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1c(F)cccc1S(=O)(=O)N1CC(O)C(O)C1 |
| InChI | InChI=1S/C11H13FN2O4S2/c12-6-2-1-3-9(10(6)11(13)19)20(17,18)14-4-7(15)8(16)5-14/h1-3,7-8,15-16H,4-5H2,(H2,13,19) |
| InChIKey | NDFQJKVLEOGOBM-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|