C12H9FN2O2S — CID 60790611
2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-6-fluorobenzenecarbothioamide (PubChem CID 60790611) has the molecular formula C12H9FN2O2S and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-6-fluorobenzenecarbothioamide.
| Compound Name | 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-6-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 60790611 |
| Molecular Formula | C12H9FN2O2S |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-6-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1c(F)cccc1N1C(=O)C2CC2C1=O |
| InChI | InChI=1S/C12H9FN2O2S/c13-7-2-1-3-8(9(7)10(14)18)15-11(16)5-4-6(5)12(15)17/h1-3,5-6H,4H2,(H2,14,18) |
| InChIKey | UHYVXUMMEXSCGT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|