About 2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide
2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide (PubChem CID 79516134) has the molecular formula C17H17FN2S
and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide.
Molecular Properties
| Compound Name | 2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide |
| PubChem CID | 79516134 |
| Molecular Formula | C17H17FN2S |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide |
| SMILES | CC1Cc2ccccc2N(c2cccc(F)c2C(N)=S)C1 |
| InChI | InChI=1S/C17H17FN2S/c1-11-9-12-5-2-3-7-14(12)20(10-11)15-8-4-6-13(18)16(15)17(19)21/h2-8,11H,9-10H2,1H3,(H2,19,21) |
| InChIKey | AGLUEGAEUNSLGX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide?
The IUPAC name of 2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide (CID 79516134) is 2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide.
What is the SMILES notation for 2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide?
The canonical SMILES for 2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide is CC1Cc2ccccc2N(c2cccc(F)c2C(N)=S)C1.
What is the InChIKey of 2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide?
The InChIKey is AGLUEGAEUNSLGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN2S/c1-11-9-12-5-2-3-7-14(12)20(10-11)15-8-4-6-13(18)16(15)17(19)21/h2-8,11H,9-10H2,1H3,(H2,19,21).
What are the key properties of 2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide?
2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide has a molecular weight of 300.40 g/mol, XLogP of 3.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide is sourced from PubChem (CID 79516134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).