C13H18N2O3S2 — CID 43093710
2-(2,6-dimethylmorpholin-4-yl)sulfonylbenzenecarbothioamide (PubChem CID 43093710) has the molecular formula C13H18N2O3S2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-(2,6-dimethylmorpholin-4-yl)sulfonylbenzenecarbothioamide.
| Compound Name | 2-(2,6-dimethylmorpholin-4-yl)sulfonylbenzenecarbothioamide |
|---|---|
| PubChem CID | 43093710 |
| Molecular Formula | C13H18N2O3S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-(2,6-dimethylmorpholin-4-yl)sulfonylbenzenecarbothioamide |
| SMILES | CC1CN(S(=O)(=O)c2ccccc2C(N)=S)CC(C)O1 |
| InChI | InChI=1S/C13H18N2O3S2/c1-9-7-15(8-10(2)18-9)20(16,17)12-6-4-3-5-11(12)13(14)19/h3-6,9-10H,7-8H2,1-2H3,(H2,14,19) |
| InChIKey | HUAMYLZQOLRIBT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|