C13H18N2O2 — CID 68507649
2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]benzamide (PubChem CID 68507649) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]benzamide.
| Compound Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]benzamide |
|---|---|
| PubChem CID | 68507649 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]benzamide |
| SMILES | C[C@H]1CN(c2ccccc2C(N)=O)C[C@H](C)O1 |
| InChI | InChI=1S/C13H18N2O2/c1-9-7-15(8-10(2)17-9)12-6-4-3-5-11(12)13(14)16/h3-6,9-10H,7-8H2,1-2H3,(H2,14,16)/t9-,10-/m0/s1 |
| InChIKey | KJJAMMLDLKLPKU-UWVGGRQHSA-N |
| XLogP | 1.40 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |