C9H12FN3O2S2 — CID 83016871
2-(dimethylaminosulfamoyl)-6-fluorobenzenecarbothioamide (PubChem CID 83016871) has the molecular formula C9H12FN3O2S2 and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-(dimethylaminosulfamoyl)-6-fluorobenzenecarbothioamide.
| Compound Name | 2-(dimethylaminosulfamoyl)-6-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 83016871 |
| Molecular Formula | C9H12FN3O2S2 |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-(dimethylaminosulfamoyl)-6-fluorobenzenecarbothioamide |
| SMILES | CN(C)NS(=O)(=O)c1cccc(F)c1C(N)=S |
| InChI | InChI=1S/C9H12FN3O2S2/c1-13(2)12-17(14,15)7-5-3-4-6(10)8(7)9(11)16/h3-5,12H,1-2H3,(H2,11,16) |
| InChIKey | SOWVWMHKHHCHGU-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|