C11H13FN2O3S2 — CID 104519330
N-(2-carbamothioyl-3-fluorophenyl)-2-methylsulfonylpropanamide (PubChem CID 104519330) has the molecular formula C11H13FN2O3S2 and a molecular weight of 304.37 g/mol. Its IUPAC name is N-(2-carbamothioyl-3-fluorophenyl)-2-methylsulfonylpropanamide.
| Compound Name | N-(2-carbamothioyl-3-fluorophenyl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 104519330 |
| Molecular Formula | C11H13FN2O3S2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(2-carbamothioyl-3-fluorophenyl)-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)Nc1cccc(F)c1C(N)=S)S(C)(=O)=O |
| InChI | InChI=1S/C11H13FN2O3S2/c1-6(19(2,16)17)11(15)14-8-5-3-4-7(12)9(8)10(13)18/h3-6H,1-2H3,(H2,13,18)(H,14,15) |
| InChIKey | MZJRLGVTENMVDH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|