C11H11FN2O3S — CID 113234246
N-(2-cyano-3-fluorophenyl)-2-methylsulfonylpropanamide (PubChem CID 113234246) has the molecular formula C11H11FN2O3S and a molecular weight of 270.28 g/mol. Its IUPAC name is N-(2-cyano-3-fluorophenyl)-2-methylsulfonylpropanamide.
| Compound Name | N-(2-cyano-3-fluorophenyl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 113234246 |
| Molecular Formula | C11H11FN2O3S |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | N-(2-cyano-3-fluorophenyl)-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)Nc1cccc(F)c1C#N)S(C)(=O)=O |
| InChI | InChI=1S/C11H11FN2O3S/c1-7(18(2,16)17)11(15)14-10-5-3-4-9(12)8(10)6-13/h3-5,7H,1-2H3,(H,14,15) |
| InChIKey | TUAFWPYFFMYNBO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |