C12H14FN3OS — CID 61154404
(2S)-2-amino-N-(2-cyano-3-fluorophenyl)-4-methylsulfanylbutanamide (PubChem CID 61154404) has the molecular formula C12H14FN3OS and a molecular weight of 267.33 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-cyano-3-fluorophenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-(2-cyano-3-fluorophenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 61154404 |
| Molecular Formula | C12H14FN3OS |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | (2S)-2-amino-N-(2-cyano-3-fluorophenyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1cccc(F)c1C#N |
| InChI | InChI=1S/C12H14FN3OS/c1-18-6-5-10(15)12(17)16-11-4-2-3-9(13)8(11)7-14/h2-4,10H,5-6,15H2,1H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | TXYBPKPDQLGAJA-JTQLQIEISA-N |
| XLogP | 1.72 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |