C11H15BrN2OS — CID 104906820
(2R)-2-amino-N-(2-bromophenyl)-4-methylsulfanylbutanamide (PubChem CID 104906820) has the molecular formula C11H15BrN2OS and a molecular weight of 303.23 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-bromophenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-(2-bromophenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104906820 |
| Molecular Formula | C11H15BrN2OS |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | (2R)-2-amino-N-(2-bromophenyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](N)C(=O)Nc1ccccc1Br |
| InChI | InChI=1S/C11H15BrN2OS/c1-16-7-6-9(13)11(15)14-10-5-3-2-4-8(10)12/h2-5,9H,6-7,13H2,1H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | ALFSTDXXAGXHIO-SECBINFHSA-N |
| XLogP | 2.47 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |