C11H14BrFN2OS — CID 107599885
(2R)-2-amino-N-(2-bromo-6-fluorophenyl)-4-methylsulfanylbutanamide (PubChem CID 107599885) has the molecular formula C11H14BrFN2OS and a molecular weight of 321.22 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-bromo-6-fluorophenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-(2-bromo-6-fluorophenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 107599885 |
| Molecular Formula | C11H14BrFN2OS |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | (2R)-2-amino-N-(2-bromo-6-fluorophenyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](N)C(=O)Nc1c(F)cccc1Br |
| InChI | InChI=1S/C11H14BrFN2OS/c1-17-6-5-9(14)11(16)15-10-7(12)3-2-4-8(10)13/h2-4,9H,5-6,14H2,1H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | FSJVAQREAVQOPF-SECBINFHSA-N |
| XLogP | 2.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |