C14H19BrN2O3S — CID 104907184
ethyl 4-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-3-bromobenzoate (PubChem CID 104907184) has the molecular formula C14H19BrN2O3S and a molecular weight of 375.29 g/mol. Its IUPAC name is ethyl 4-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-3-bromobenzoate.
| Compound Name | ethyl 4-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-3-bromobenzoate |
|---|---|
| PubChem CID | 104907184 |
| Molecular Formula | C14H19BrN2O3S |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | ethyl 4-[[(2R)-2-amino-4-methylsulfanylbutanoyl]amino]-3-bromobenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)[C@H](N)CCSC)c(Br)c1 |
| InChI | InChI=1S/C14H19BrN2O3S/c1-3-20-14(19)9-4-5-12(10(15)8-9)17-13(18)11(16)6-7-21-2/h4-5,8,11H,3,6-7,16H2,1-2H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | UCFZUVIMNWKTNI-LLVKDONJSA-N |
| XLogP | 2.64 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |