C13H17BrN2O4 — CID 81082689
ethyl 4-[(2-amino-3-methoxypropanoyl)amino]-3-bromobenzoate (PubChem CID 81082689) has the molecular formula C13H17BrN2O4 and a molecular weight of 345.19 g/mol. Its IUPAC name is ethyl 4-[(2-amino-3-methoxypropanoyl)amino]-3-bromobenzoate.
| Compound Name | ethyl 4-[(2-amino-3-methoxypropanoyl)amino]-3-bromobenzoate |
|---|---|
| PubChem CID | 81082689 |
| Molecular Formula | C13H17BrN2O4 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | ethyl 4-[(2-amino-3-methoxypropanoyl)amino]-3-bromobenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(N)COC)c(Br)c1 |
| InChI | InChI=1S/C13H17BrN2O4/c1-3-20-13(18)8-4-5-11(9(14)6-8)16-12(17)10(15)7-19-2/h4-6,10H,3,7,15H2,1-2H3,(H,16,17) |
| InChIKey | YGLROONJSWXZCP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |