C15H21BrN2O3 — CID 107143990
ethyl 4-[[(2S)-2-aminohexanoyl]amino]-3-bromobenzoate (PubChem CID 107143990) has the molecular formula C15H21BrN2O3 and a molecular weight of 357.25 g/mol. Its IUPAC name is ethyl 4-[[(2S)-2-aminohexanoyl]amino]-3-bromobenzoate.
| Compound Name | ethyl 4-[[(2S)-2-aminohexanoyl]amino]-3-bromobenzoate |
|---|---|
| PubChem CID | 107143990 |
| Molecular Formula | C15H21BrN2O3 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | ethyl 4-[[(2S)-2-aminohexanoyl]amino]-3-bromobenzoate |
| SMILES | CCCC[C@H](N)C(=O)Nc1ccc(C(=O)OCC)cc1Br |
| InChI | InChI=1S/C15H21BrN2O3/c1-3-5-6-12(17)14(19)18-13-8-7-10(9-11(13)16)15(20)21-4-2/h7-9,12H,3-6,17H2,1-2H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | TWOMWSWBUGGVMH-LBPRGKRZSA-N |
| XLogP | 3.08 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |