C12H12FN3O3 — CID 62639026
2-[(2-cyano-3-fluorophenyl)carbamoyl-methylamino]propanoic acid (PubChem CID 62639026) has the molecular formula C12H12FN3O3 and a molecular weight of 265.24 g/mol. Its IUPAC name is 2-[(2-cyano-3-fluorophenyl)carbamoyl-methylamino]propanoic acid.
| Compound Name | 2-[(2-cyano-3-fluorophenyl)carbamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 62639026 |
| Molecular Formula | C12H12FN3O3 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-[(2-cyano-3-fluorophenyl)carbamoyl-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)Nc1cccc(F)c1C#N |
| InChI | InChI=1S/C12H12FN3O3/c1-7(11(17)18)16(2)12(19)15-10-5-3-4-9(13)8(10)6-14/h3-5,7H,1-2H3,(H,15,19)(H,17,18) |
| InChIKey | IDYUZRXGKDYHBI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |