C11H11FN2OS — CID 43580877
N-(2-carbamothioyl-3-fluorophenyl)cyclopropanecarboxamide (PubChem CID 43580877) has the molecular formula C11H11FN2OS and a molecular weight of 238.29 g/mol. Its IUPAC name is N-(2-carbamothioyl-3-fluorophenyl)cyclopropanecarboxamide.
| Compound Name | N-(2-carbamothioyl-3-fluorophenyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 43580877 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | N-(2-carbamothioyl-3-fluorophenyl)cyclopropanecarboxamide |
| SMILES | NC(=S)c1c(F)cccc1NC(=O)C1CC1 |
| InChI | InChI=1S/C11H11FN2OS/c12-7-2-1-3-8(9(7)10(13)16)14-11(15)6-4-5-6/h1-3,6H,4-5H2,(H2,13,16)(H,14,15) |
| InChIKey | SOOHDLVRVDLWFF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|