C12H14FN3OS — CID 116658288
1-(2-carbamothioyl-3-fluorophenyl)-3-cyclobutylurea (PubChem CID 116658288) has the molecular formula C12H14FN3OS and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-(2-carbamothioyl-3-fluorophenyl)-3-cyclobutylurea.
| Compound Name | 1-(2-carbamothioyl-3-fluorophenyl)-3-cyclobutylurea |
|---|---|
| PubChem CID | 116658288 |
| Molecular Formula | C12H14FN3OS |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 1-(2-carbamothioyl-3-fluorophenyl)-3-cyclobutylurea |
| SMILES | NC(=S)c1c(F)cccc1NC(=O)NC1CCC1 |
| InChI | InChI=1S/C12H14FN3OS/c13-8-5-2-6-9(10(8)11(14)18)16-12(17)15-7-3-1-4-7/h2,5-7H,1,3-4H2,(H2,14,18)(H2,15,16,17) |
| InChIKey | RDKLHUIPOQRLHW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|