C14H11F2N3OS — CID 43581005
1-(2-carbamothioyl-3-fluorophenyl)-3-(4-fluorophenyl)urea (PubChem CID 43581005) has the molecular formula C14H11F2N3OS and a molecular weight of 307.32 g/mol. Its IUPAC name is 1-(2-carbamothioyl-3-fluorophenyl)-3-(4-fluorophenyl)urea.
| Compound Name | 1-(2-carbamothioyl-3-fluorophenyl)-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 43581005 |
| Molecular Formula | C14H11F2N3OS |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 1-(2-carbamothioyl-3-fluorophenyl)-3-(4-fluorophenyl)urea |
| SMILES | NC(=S)c1c(F)cccc1NC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H11F2N3OS/c15-8-4-6-9(7-5-8)18-14(20)19-11-3-1-2-10(16)12(11)13(17)21/h1-7H,(H2,17,21)(H2,18,19,20) |
| InChIKey | ZAYQAOSWJKYKRK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|