C8H9F3N2O2S — CID 115405345
2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide (PubChem CID 115405345) has the molecular formula C8H9F3N2O2S and a molecular weight of 254.23 g/mol. Its IUPAC name is 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide.
| Compound Name | 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 115405345 |
| Molecular Formula | C8H9F3N2O2S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide |
| SMILES | Nc1cccc(F)c1S(=O)(=O)NCC(F)F |
| InChI | InChI=1S/C8H9F3N2O2S/c9-5-2-1-3-6(12)8(5)16(14,15)13-4-7(10)11/h1-3,7,13H,4,12H2 |
| InChIKey | NYVFNJWWPLHZCZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|