About 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide
2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide (PubChem CID 115405345) has the molecular formula C8H9F3N2O2S
and a molecular weight of 254.23 g/mol. Its IUPAC name is 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide |
| PubChem CID | 115405345 |
| Molecular Formula | C8H9F3N2O2S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide |
| SMILES | Nc1cccc(F)c1S(=O)(=O)NCC(F)F |
| InChI | InChI=1S/C8H9F3N2O2S/c9-5-2-1-3-6(12)8(5)16(14,15)13-4-7(10)11/h1-3,7,13H,4,12H2 |
| InChIKey | NYVFNJWWPLHZCZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide?
The IUPAC name of 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide (CID 115405345) is 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide.
What is the SMILES notation for 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide?
The canonical SMILES for 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide is Nc1cccc(F)c1S(=O)(=O)NCC(F)F.
What is the InChIKey of 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide?
The InChIKey is NYVFNJWWPLHZCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O2S/c9-5-2-1-3-6(12)8(5)16(14,15)13-4-7(10)11/h1-3,7,13H,4,12H2.
What are the key properties of 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide?
2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide has a molecular weight of 254.23 g/mol, XLogP of 0.95, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(2,2-difluoroethyl)-6-fluorobenzenesulfonamide is sourced from PubChem (CID 115405345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).