C9H12FN3O4S — CID 83202803
2-[(2-amino-6-fluorophenyl)sulfonylamino]ethyl carbamate (PubChem CID 83202803) has the molecular formula C9H12FN3O4S and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[(2-amino-6-fluorophenyl)sulfonylamino]ethyl carbamate.
| Compound Name | 2-[(2-amino-6-fluorophenyl)sulfonylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83202803 |
| Molecular Formula | C9H12FN3O4S |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-[(2-amino-6-fluorophenyl)sulfonylamino]ethyl carbamate |
| SMILES | NC(=O)OCCNS(=O)(=O)c1c(N)cccc1F |
| InChI | InChI=1S/C9H12FN3O4S/c10-6-2-1-3-7(11)8(6)18(15,16)13-4-5-17-9(12)14/h1-3,13H,4-5,11H2,(H2,12,14) |
| InChIKey | GKWBULWHLQOVHQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|