C10H15FN2O3S2 — CID 113487178
2-amino-6-fluoro-N-(3-methylsulfinylpropyl)benzenesulfonamide (PubChem CID 113487178) has the molecular formula C10H15FN2O3S2 and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-(3-methylsulfinylpropyl)benzenesulfonamide.
| Compound Name | 2-amino-6-fluoro-N-(3-methylsulfinylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113487178 |
| Molecular Formula | C10H15FN2O3S2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-amino-6-fluoro-N-(3-methylsulfinylpropyl)benzenesulfonamide |
| SMILES | CS(=O)CCCNS(=O)(=O)c1c(N)cccc1F |
| InChI | InChI=1S/C10H15FN2O3S2/c1-17(14)7-3-6-13-18(15,16)10-8(11)4-2-5-9(10)12/h2,4-5,13H,3,6-7,12H2,1H3 |
| InChIKey | LRIJMDPFHFZZMF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|