C10H16N2O5S3 — CID 115632032
4-N-(3-methylsulfinylpropyl)benzene-1,4-disulfonamide (PubChem CID 115632032) has the molecular formula C10H16N2O5S3 and a molecular weight of 340.45 g/mol. Its IUPAC name is 4-N-(3-methylsulfinylpropyl)benzene-1,4-disulfonamide.
| Compound Name | 4-N-(3-methylsulfinylpropyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 115632032 |
| Molecular Formula | C10H16N2O5S3 |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 4-N-(3-methylsulfinylpropyl)benzene-1,4-disulfonamide |
| SMILES | CS(=O)CCCNS(=O)(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H16N2O5S3/c1-18(13)8-2-7-12-20(16,17)10-5-3-9(4-6-10)19(11,14)15/h3-6,12H,2,7-8H2,1H3,(H2,11,14,15) |
| InChIKey | KCLNLTQEAFYHCU-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|