C19H26N4O4S2 — CID 55641989
4-N-[3-(4-phenylpiperazin-1-yl)propyl]benzene-1,4-disulfonamide (PubChem CID 55641989) has the molecular formula C19H26N4O4S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is 4-N-[3-(4-phenylpiperazin-1-yl)propyl]benzene-1,4-disulfonamide.
| Compound Name | 4-N-[3-(4-phenylpiperazin-1-yl)propyl]benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 55641989 |
| Molecular Formula | C19H26N4O4S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 4-N-[3-(4-phenylpiperazin-1-yl)propyl]benzene-1,4-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)NCCCN2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H26N4O4S2/c20-28(24,25)18-7-9-19(10-8-18)29(26,27)21-11-4-12-22-13-15-23(16-14-22)17-5-2-1-3-6-17/h1-3,5-10,21H,4,11-16H2,(H2,20,24,25) |
| InChIKey | LWZDKAYAIGMHJH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|