C23H33N3O3S — CID 42389225
4-ethoxy-3,5-dimethyl-N-[3-(4-phenylpiperazin-1-yl)propyl]benzenesulfonamide (PubChem CID 42389225) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is 4-ethoxy-3,5-dimethyl-N-[3-(4-phenylpiperazin-1-yl)propyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-3,5-dimethyl-N-[3-(4-phenylpiperazin-1-yl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 42389225 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 4-ethoxy-3,5-dimethyl-N-[3-(4-phenylpiperazin-1-yl)propyl]benzenesulfonamide |
| SMILES | CCOc1c(C)cc(S(=O)(=O)NCCCN2CCN(c3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C23H33N3O3S/c1-4-29-23-19(2)17-22(18-20(23)3)30(27,28)24-11-8-12-25-13-15-26(16-14-25)21-9-6-5-7-10-21/h5-7,9-10,17-18,24H,4,8,11-16H2,1-3H3 |
| InChIKey | UXCMBJISDNBZPC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|