C23H30N4O3S — CID 45106786
2-oxo-N-[3-(4-phenylpiperazin-1-yl)propyl]-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide (PubChem CID 45106786) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is 2-oxo-N-[3-(4-phenylpiperazin-1-yl)propyl]-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide.
| Compound Name | 2-oxo-N-[3-(4-phenylpiperazin-1-yl)propyl]-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide |
|---|---|
| PubChem CID | 45106786 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 2-oxo-N-[3-(4-phenylpiperazin-1-yl)propyl]-1,3,4,5-tetrahydro-1-benzazepine-7-sulfonamide |
| SMILES | O=C1CCCc2cc(S(=O)(=O)NCCCN3CCN(c4ccccc4)CC3)ccc2N1 |
| InChI | InChI=1S/C23H30N4O3S/c28-23-9-4-6-19-18-21(10-11-22(19)25-23)31(29,30)24-12-5-13-26-14-16-27(17-15-26)20-7-2-1-3-8-20/h1-3,7-8,10-11,18,24H,4-6,9,12-17H2,(H,25,28) |
| InChIKey | MQUBQUJDQPFFIT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|