C13H19N3O5S2 — CID 18227621
4-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzene-1,4-disulfonamide (PubChem CID 18227621) has the molecular formula C13H19N3O5S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 4-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzene-1,4-disulfonamide.
| Compound Name | 4-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 18227621 |
| Molecular Formula | C13H19N3O5S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 4-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzene-1,4-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)NCCCN2CCCC2=O)cc1 |
| InChI | InChI=1S/C13H19N3O5S2/c14-22(18,19)11-4-6-12(7-5-11)23(20,21)15-8-2-10-16-9-1-3-13(16)17/h4-7,15H,1-3,8-10H2,(H2,14,18,19) |
| InChIKey | QGFGIBQGPHKPJL-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|