C15H21N3O4S — CID 51075115
N-methyl-4-[3-(2-oxopyrrolidin-1-yl)propylsulfamoyl]benzamide (PubChem CID 51075115) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is N-methyl-4-[3-(2-oxopyrrolidin-1-yl)propylsulfamoyl]benzamide.
| Compound Name | N-methyl-4-[3-(2-oxopyrrolidin-1-yl)propylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 51075115 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-methyl-4-[3-(2-oxopyrrolidin-1-yl)propylsulfamoyl]benzamide |
| SMILES | CNC(=O)c1ccc(S(=O)(=O)NCCCN2CCCC2=O)cc1 |
| InChI | InChI=1S/C15H21N3O4S/c1-16-15(20)12-5-7-13(8-6-12)23(21,22)17-9-3-11-18-10-2-4-14(18)19/h5-8,17H,2-4,9-11H2,1H3,(H,16,20) |
| InChIKey | HMHYEDYSZIHZOG-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|