C21H24N4O6S — CID 25342302
4-[(4-methyl-3-nitrophenyl)sulfonylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide (PubChem CID 25342302) has the molecular formula C21H24N4O6S and a molecular weight of 460.51 g/mol. Its IUPAC name is 4-[(4-methyl-3-nitrophenyl)sulfonylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide.
| Compound Name | 4-[(4-methyl-3-nitrophenyl)sulfonylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 25342302 |
| Molecular Formula | C21H24N4O6S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | 4-[(4-methyl-3-nitrophenyl)sulfonylamino]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)NCCCN3CCCC3=O)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N4O6S/c1-15-5-10-18(14-19(15)25(28)29)32(30,31)23-17-8-6-16(7-9-17)21(27)22-11-3-13-24-12-2-4-20(24)26/h5-10,14,23H,2-4,11-13H2,1H3,(H,22,27) |
| InChIKey | DQTFTTRSSIBLOK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|