C23H33N5O6 — CID 71236137
tert-butyl 4-[2-nitro-4-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]phenyl]piperazine-1-carboxylate (PubChem CID 71236137) has the molecular formula C23H33N5O6 and a molecular weight of 475.55 g/mol. Its IUPAC name is tert-butyl 4-[2-nitro-4-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-nitro-4-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71236137 |
| Molecular Formula | C23H33N5O6 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | tert-butyl 4-[2-nitro-4-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C(=O)NCCCN3CCCC3=O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C23H33N5O6/c1-23(2,3)34-22(31)27-14-12-25(13-15-27)18-8-7-17(16-19(18)28(32)33)21(30)24-9-5-11-26-10-4-6-20(26)29/h7-8,16H,4-6,9-15H2,1-3H3,(H,24,30) |
| InChIKey | LKPUBAFVFICXOS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|