C26H32N4O5 — CID 145482017
tert-butyl N-[2-[[4-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]benzoyl]amino]phenyl]carbamate (PubChem CID 145482017) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 145482017 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | tert-butyl N-[2-[[4-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]benzoyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1NC(=O)c1ccc(C(=O)NCCCN2CCCC2=O)cc1 |
| InChI | InChI=1S/C26H32N4O5/c1-26(2,3)35-25(34)29-21-9-5-4-8-20(21)28-24(33)19-13-11-18(12-14-19)23(32)27-15-7-17-30-16-6-10-22(30)31/h4-5,8-9,11-14H,6-7,10,15-17H2,1-3H3,(H,27,32)(H,28,33)(H,29,34) |
| InChIKey | OKNXTNAJRIONFE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|