C23H35N5O4 — CID 89394489
tert-butyl 4-[2-amino-4-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]phenyl]piperazine-1-carboxylate (PubChem CID 89394489) has the molecular formula C23H35N5O4 and a molecular weight of 445.56 g/mol. Its IUPAC name is tert-butyl 4-[2-amino-4-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-amino-4-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 89394489 |
| Molecular Formula | C23H35N5O4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | tert-butyl 4-[2-amino-4-[3-(2-oxopyrrolidin-1-yl)propylcarbamoyl]phenyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C(=O)NCCCN3CCCC3=O)cc2N)CC1 |
| InChI | InChI=1S/C23H35N5O4/c1-23(2,3)32-22(31)28-14-12-26(13-15-28)19-8-7-17(16-18(19)24)21(30)25-9-5-11-27-10-4-6-20(27)29/h7-8,16H,4-6,9-15,24H2,1-3H3,(H,25,30) |
| InChIKey | ICDZGHSTNCCTDS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|