C23H29ClN6O2 — CID 89388512
3-amino-4-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide (PubChem CID 89388512) has the molecular formula C23H29ClN6O2 and a molecular weight of 456.98 g/mol. Its IUPAC name is 3-amino-4-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide.
| Compound Name | 3-amino-4-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 89388512 |
| Molecular Formula | C23H29ClN6O2 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 3-amino-4-[4-(3-chloro-2-pyridinyl)piperazin-1-yl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzamide |
| SMILES | Nc1cc(C(=O)NCCCN2CCCC2=O)ccc1N1CCN(c2ncccc2Cl)CC1 |
| InChI | InChI=1S/C23H29ClN6O2/c24-18-4-1-8-26-22(18)30-14-12-28(13-15-30)20-7-6-17(16-19(20)25)23(32)27-9-3-11-29-10-2-5-21(29)31/h1,4,6-8,16H,2-3,5,9-15,25H2,(H,27,32) |
| InChIKey | OOFSMCIVCCIDQW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|