C27H34N4O3 — CID 71224431
4-[4-(2-methylphenyl)piperidin-1-yl]-1-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzene-1,3-dicarboxamide (PubChem CID 71224431) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 4-[4-(2-methylphenyl)piperidin-1-yl]-1-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzene-1,3-dicarboxamide.
| Compound Name | 4-[4-(2-methylphenyl)piperidin-1-yl]-1-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 71224431 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 4-[4-(2-methylphenyl)piperidin-1-yl]-1-N-[3-(2-oxopyrrolidin-1-yl)propyl]benzene-1,3-dicarboxamide |
| SMILES | Cc1ccccc1C1CCN(c2ccc(C(=O)NCCCN3CCCC3=O)cc2C(N)=O)CC1 |
| InChI | InChI=1S/C27H34N4O3/c1-19-6-2-3-7-22(19)20-11-16-30(17-12-20)24-10-9-21(18-23(24)26(28)33)27(34)29-13-5-15-31-14-4-8-25(31)32/h2-3,6-7,9-10,18,20H,4-5,8,11-17H2,1H3,(H2,28,33)(H,29,34) |
| InChIKey | ZTDAZBFKSMSXBP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|