C26H34N4O4 — CID 58001206
tert-butyl N-[2-[[4-[[3-(2-oxopyrrolidin-1-yl)propylamino]methyl]benzoyl]amino]phenyl]carbamate (PubChem CID 58001206) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[[3-(2-oxopyrrolidin-1-yl)propylamino]methyl]benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[[3-(2-oxopyrrolidin-1-yl)propylamino]methyl]benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 58001206 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | tert-butyl N-[2-[[4-[[3-(2-oxopyrrolidin-1-yl)propylamino]methyl]benzoyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccccc1NC(=O)c1ccc(CNCCCN2CCCC2=O)cc1 |
| InChI | InChI=1S/C26H34N4O4/c1-26(2,3)34-25(33)29-22-9-5-4-8-21(22)28-24(32)20-13-11-19(12-14-20)18-27-15-7-17-30-16-6-10-23(30)31/h4-5,8-9,11-14,27H,6-7,10,15-18H2,1-3H3,(H,28,32)(H,29,33) |
| InChIKey | CFXCNXRGBSBPFQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|