C21H25N3O4S — CID 46636864
tert-butyl N-[[4-[[2-(2-amino-2-oxoethyl)sulfanylphenyl]carbamoyl]phenyl]methyl]carbamate (PubChem CID 46636864) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is tert-butyl N-[[4-[[2-(2-amino-2-oxoethyl)sulfanylphenyl]carbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[2-(2-amino-2-oxoethyl)sulfanylphenyl]carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 46636864 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | tert-butyl N-[[4-[[2-(2-amino-2-oxoethyl)sulfanylphenyl]carbamoyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C(=O)Nc2ccccc2SCC(N)=O)cc1 |
| InChI | InChI=1S/C21H25N3O4S/c1-21(2,3)28-20(27)23-12-14-8-10-15(11-9-14)19(26)24-16-6-4-5-7-17(16)29-13-18(22)25/h4-11H,12-13H2,1-3H3,(H2,22,25)(H,23,27)(H,24,26) |
| InChIKey | VGOGKKWNZCBGMO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |