C15H12F2N2O2S — CID 78810118
N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3,4-difluorobenzamide (PubChem CID 78810118) has the molecular formula C15H12F2N2O2S and a molecular weight of 322.34 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3,4-difluorobenzamide.
| Compound Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 78810118 |
| Molecular Formula | C15H12F2N2O2S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3,4-difluorobenzamide |
| SMILES | NC(=O)CSc1ccccc1NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H12F2N2O2S/c16-10-6-5-9(7-11(10)17)15(21)19-12-3-1-2-4-13(12)22-8-14(18)20/h1-7H,8H2,(H2,18,20)(H,19,21) |
| InChIKey | ASHUJSPSZUSAGB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |