C17H17FN2O2S — CID 78810399
N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-(2-fluorophenyl)propanamide (PubChem CID 78810399) has the molecular formula C17H17FN2O2S and a molecular weight of 332.40 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-(2-fluorophenyl)propanamide.
| Compound Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-(2-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 78810399 |
| Molecular Formula | C17H17FN2O2S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-3-(2-fluorophenyl)propanamide |
| SMILES | NC(=O)CSc1ccccc1NC(=O)CCc1ccccc1F |
| InChI | InChI=1S/C17H17FN2O2S/c18-13-6-2-1-5-12(13)9-10-17(22)20-14-7-3-4-8-15(14)23-11-16(19)21/h1-8H,9-11H2,(H2,19,21)(H,20,22) |
| InChIKey | TXAKCXSSVARHTO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |