C19H20N2O3S — CID 78810130
N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-4-(4-methylphenyl)-4-oxobutanamide (PubChem CID 78810130) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-4-(4-methylphenyl)-4-oxobutanamide.
| Compound Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-4-(4-methylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 78810130 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | N-[2-(2-amino-2-oxoethyl)sulfanylphenyl]-4-(4-methylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)Nc2ccccc2SCC(N)=O)cc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-13-6-8-14(9-7-13)16(22)10-11-19(24)21-15-4-2-3-5-17(15)25-12-18(20)23/h2-9H,10-12H2,1H3,(H2,20,23)(H,21,24) |
| InChIKey | FSDINBHVZURCLL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |