C17H16ClNO2S — CID 38168905
4-(4-chlorophenyl)-N-(2-methylsulfanylphenyl)-4-oxobutanamide (PubChem CID 38168905) has the molecular formula C17H16ClNO2S and a molecular weight of 333.84 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(2-methylsulfanylphenyl)-4-oxobutanamide.
| Compound Name | 4-(4-chlorophenyl)-N-(2-methylsulfanylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 38168905 |
| Molecular Formula | C17H16ClNO2S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(2-methylsulfanylphenyl)-4-oxobutanamide |
| SMILES | CSc1ccccc1NC(=O)CCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO2S/c1-22-16-5-3-2-4-14(16)19-17(21)11-10-15(20)12-6-8-13(18)9-7-12/h2-9H,10-11H2,1H3,(H,19,21) |
| InChIKey | GHYQSEMSWVUUNJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |