C17H18N2O2S2 — CID 27015578
2-[2-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]sulfanylacetamide (PubChem CID 27015578) has the molecular formula C17H18N2O2S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 2-[2-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]sulfanylacetamide.
| Compound Name | 2-[2-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 27015578 |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-[2-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]sulfanylacetamide |
| SMILES | Cc1ccc(SCC(=O)Nc2ccccc2SCC(N)=O)cc1 |
| InChI | InChI=1S/C17H18N2O2S2/c1-12-6-8-13(9-7-12)22-11-17(21)19-14-4-2-3-5-15(14)23-10-16(18)20/h2-9H,10-11H2,1H3,(H2,18,20)(H,19,21) |
| InChIKey | YCYXHZOLDUDZLD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |