C18H22N2OS — CID 119438694
N-[2-(ethylaminomethyl)phenyl]-2-(4-methylphenyl)sulfanylacetamide (PubChem CID 119438694) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is N-[2-(ethylaminomethyl)phenyl]-2-(4-methylphenyl)sulfanylacetamide.
| Compound Name | N-[2-(ethylaminomethyl)phenyl]-2-(4-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 119438694 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-[2-(ethylaminomethyl)phenyl]-2-(4-methylphenyl)sulfanylacetamide |
| SMILES | CCNCc1ccccc1NC(=O)CSc1ccc(C)cc1 |
| InChI | InChI=1S/C18H22N2OS/c1-3-19-12-15-6-4-5-7-17(15)20-18(21)13-22-16-10-8-14(2)9-11-16/h4-11,19H,3,12-13H2,1-2H3,(H,20,21) |
| InChIKey | RGPHATMWXZRVDW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |