C15H14ClFN2OS — CID 115762712
2-[2-[(5-chloro-2-fluorophenyl)methylamino]phenyl]sulfanylacetamide (PubChem CID 115762712) has the molecular formula C15H14ClFN2OS and a molecular weight of 324.81 g/mol. Its IUPAC name is 2-[2-[(5-chloro-2-fluorophenyl)methylamino]phenyl]sulfanylacetamide.
| Compound Name | 2-[2-[(5-chloro-2-fluorophenyl)methylamino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 115762712 |
| Molecular Formula | C15H14ClFN2OS |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-[2-[(5-chloro-2-fluorophenyl)methylamino]phenyl]sulfanylacetamide |
| SMILES | NC(=O)CSc1ccccc1NCc1cc(Cl)ccc1F |
| InChI | InChI=1S/C15H14ClFN2OS/c16-11-5-6-12(17)10(7-11)8-19-13-3-1-2-4-14(13)21-9-15(18)20/h1-7,19H,8-9H2,(H2,18,20) |
| InChIKey | GAQGQADVSQGWBL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |