C24H26N4O3 — CID 25150915
tert-butyl N-[[4-[(3-amino-6-phenyl-2-pyridinyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 25150915) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is tert-butyl N-[[4-[(3-amino-6-phenyl-2-pyridinyl)carbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(3-amino-6-phenyl-2-pyridinyl)carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 25150915 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | tert-butyl N-[[4-[(3-amino-6-phenyl-2-pyridinyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C(=O)Nc2nc(-c3ccccc3)ccc2N)cc1 |
| InChI | InChI=1S/C24H26N4O3/c1-24(2,3)31-23(30)26-15-16-9-11-18(12-10-16)22(29)28-21-19(25)13-14-20(27-21)17-7-5-4-6-8-17/h4-14H,15,25H2,1-3H3,(H,26,30)(H,27,28,29) |
| InChIKey | ZBQMSKMXGCSGKO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |